| HABA; 2-(p-hydroxyphenylazo)benzoic acid; 2-(4-hydroxyphenylazo)benzoic acid; 2-[(4-hydroxyphenyl)diazenyl]benzoic acid | |
| MeSH: | Fluorescent Dyes; Indicators and Reagents; Luminescent Agents; Fluorescent Dyes; Indicators and Reagents; Luminescent Agents |
| CAS RN: | [1634-82-8] |
| Formula: | C13H10N2O3; 242.23 g/mol |
| InChiKey: | DWQOTEPNRWVUDA-UHFFFAOYSA-N |
| SMILES: | Oc1ccc(cc1)N=Nc2ccccc2C(O)=O |
| Melting point: | 205 °C |
| 2-amino-5-nitrobenzophenone |
| 4-amino-3-nitrobenzophenone |
| 2-(4-hydroxyphenyl-azo)benzoic acid |
| 2-hydroxy-5-(phenylazo)benzoic acid |
| 4-(4'-hydroxyphenylazo)benzoic acid |
| 2-[(4-hydroxyphenyl)diazenyl]benzoic acid |
| 3-[(4-hydroxyphenyl)diazenyl]benzoic acid |
| 2-nitro-N-phenylbenzamide |
| N-(2-nitrophenyl)benzamide |
| 3-nitro-N-phenylbenzamide |
| N-(3-nitrophenyl)benzamide |
| 4-nitro-N-phenylbenzamide |
| N-(4-nitrophenyl)benzamide |
| 2-[(3-nitrophenyl)methylideneamino]phenol |
| (E)-1-(4-nitrophenyl)-3-(1H-pyrrol-2-yl)prop-2-en-1-one |
| (E)-3-(4-nitrophenyl)-1-(1H-pyrrol-2-yl)prop-2-en-1-one |
| 4-(pyridine-3-carbonylamino)benzoic acid |